C15H23NO3 — CID 103712693
N-(2-hydroxy-4-methoxy-2-methylbutyl)-2,5-dimethylbenzamide (PubChem CID 103712693) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-(2-hydroxy-4-methoxy-2-methylbutyl)-2,5-dimethylbenzamide.
| Compound Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 103712693 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-(2-hydroxy-4-methoxy-2-methylbutyl)-2,5-dimethylbenzamide |
| SMILES | COCCC(C)(O)CNC(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H23NO3/c1-11-5-6-12(2)13(9-11)14(17)16-10-15(3,18)7-8-19-4/h5-6,9,18H,7-8,10H2,1-4H3,(H,16,17) |
| InChIKey | ABTUTZKUOIUKFU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |