C13H16ClF2NO3 — CID 103873644
4-chloro-2,5-difluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide (PubChem CID 103873644) has the molecular formula C13H16ClF2NO3 and a molecular weight of 307.72 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide |
|---|---|
| PubChem CID | 103873644 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-(2-hydroxy-4-methoxy-2-methylbutyl)benzamide |
| SMILES | COCCC(C)(O)CNC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H16ClF2NO3/c1-13(19,3-4-20-2)7-17-12(18)8-5-11(16)9(14)6-10(8)15/h5-6,19H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | HNZBWCFIXRLCMZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|