C14H18Cl2FNO2 — CID 103899579
2,4-dichloro-5-fluoro-N-(5-hydroxy-2,2-dimethylpentyl)benzamide (PubChem CID 103899579) has the molecular formula C14H18Cl2FNO2 and a molecular weight of 322.21 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(5-hydroxy-2,2-dimethylpentyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(5-hydroxy-2,2-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 103899579 |
| Molecular Formula | C14H18Cl2FNO2 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(5-hydroxy-2,2-dimethylpentyl)benzamide |
| SMILES | CC(C)(CCCO)CNC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2FNO2/c1-14(2,4-3-5-19)8-18-13(20)9-6-12(17)11(16)7-10(9)15/h6-7,19H,3-5,8H2,1-2H3,(H,18,20) |
| InChIKey | HOWYJWSKLASGCN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|