C14H18Cl3NO — CID 106144748
2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)benzamide (PubChem CID 106144748) has the molecular formula C14H18Cl3NO and a molecular weight of 322.66 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)benzamide.
| Compound Name | 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 106144748 |
| Molecular Formula | C14H18Cl3NO |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2,5-dichloro-N-(5-chloro-2,2-dimethylpentyl)benzamide |
| SMILES | CC(C)(CCCCl)CNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl3NO/c1-14(2,6-3-7-15)9-18-13(19)11-8-10(16)4-5-12(11)17/h4-5,8H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | UNPCIJGZPWNGHT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|