C14H18Cl2FNO — CID 106144546
5-chloro-N-(5-chloro-2,2-dimethylpentyl)-2-fluorobenzamide (PubChem CID 106144546) has the molecular formula C14H18Cl2FNO and a molecular weight of 306.21 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2,2-dimethylpentyl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(5-chloro-2,2-dimethylpentyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 106144546 |
| Molecular Formula | C14H18Cl2FNO |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-chloro-N-(5-chloro-2,2-dimethylpentyl)-2-fluorobenzamide |
| SMILES | CC(C)(CCCCl)CNC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H18Cl2FNO/c1-14(2,6-3-7-15)9-18-13(19)11-8-10(16)4-5-12(11)17/h4-5,8H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | WZGRNYZVZGROOV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|