C14H20ClNO3 — CID 106141392
2-chloro-5-hydroxy-N-(5-hydroxy-2,2-dimethylpentyl)benzamide (PubChem CID 106141392) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-(5-hydroxy-2,2-dimethylpentyl)benzamide.
| Compound Name | 2-chloro-5-hydroxy-N-(5-hydroxy-2,2-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 106141392 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-chloro-5-hydroxy-N-(5-hydroxy-2,2-dimethylpentyl)benzamide |
| SMILES | CC(C)(CCCO)CNC(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C14H20ClNO3/c1-14(2,6-3-7-17)9-16-13(19)11-8-10(18)4-5-12(11)15/h4-5,8,17-18H,3,6-7,9H2,1-2H3,(H,16,19) |
| InChIKey | UMZPZJDQUVHGKK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |