C14H19BrClNO2 — CID 114149605
5-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-hydroxybenzamide (PubChem CID 114149605) has the molecular formula C14H19BrClNO2 and a molecular weight of 348.67 g/mol. Its IUPAC name is 5-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 114149605 |
| Molecular Formula | C14H19BrClNO2 |
| Molecular Weight | 348.67 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-bromo-N-(5-chloro-2,2-dimethylpentyl)-2-hydroxybenzamide |
| SMILES | CC(C)(CCCCl)CNC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H19BrClNO2/c1-14(2,6-3-7-16)9-17-13(19)11-8-10(15)4-5-12(11)18/h4-5,8,18H,3,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | LNSSSOXIQQENCD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|