C13H17ClFNO2 — CID 106142770
N-(4-chloro-2,2-dimethylbutyl)-5-fluoro-2-hydroxybenzamide (PubChem CID 106142770) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 106142770 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-5-fluoro-2-hydroxybenzamide |
| SMILES | CC(C)(CCCl)CNC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C13H17ClFNO2/c1-13(2,5-6-14)8-16-12(18)10-7-9(15)3-4-11(10)17/h3-4,7,17H,5-6,8H2,1-2H3,(H,16,18) |
| InChIKey | FHRLRDXWQZEEQH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|