C14H18ClFN2O3 — CID 106144371
N-(5-chloro-2,2-dimethylpentyl)-5-fluoro-2-nitrobenzamide (PubChem CID 106144371) has the molecular formula C14H18ClFN2O3 and a molecular weight of 316.76 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-5-fluoro-2-nitrobenzamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-5-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 106144371 |
| Molecular Formula | C14H18ClFN2O3 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-5-fluoro-2-nitrobenzamide |
| SMILES | CC(C)(CCCCl)CNC(=O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18ClFN2O3/c1-14(2,6-3-7-15)9-17-13(19)11-8-10(16)4-5-12(11)18(20)21/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | QVJGPHPMOORHLQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|