C10H10F3N3O3 — CID 114383355
N-(3-amino-2,2-difluoropropyl)-5-fluoro-2-nitrobenzamide (PubChem CID 114383355) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-5-fluoro-2-nitrobenzamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-5-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 114383355 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-5-fluoro-2-nitrobenzamide |
| SMILES | NCC(F)(F)CNC(=O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10F3N3O3/c11-6-1-2-8(16(18)19)7(3-6)9(17)15-5-10(12,13)4-14/h1-3H,4-5,14H2,(H,15,17) |
| InChIKey | OQPTYFONUBERNC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|