C10H9F3N2O4 — CID 104858227
N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-nitrobenzamide (PubChem CID 104858227) has the molecular formula C10H9F3N2O4 and a molecular weight of 278.19 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-nitrobenzamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 104858227 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-4-fluoro-2-nitrobenzamide |
| SMILES | O=C(NCC(F)(F)CO)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N2O4/c11-6-1-2-7(8(3-6)15(18)19)9(17)14-4-10(12,13)5-16/h1-3,16H,4-5H2,(H,14,17) |
| InChIKey | MXQBYICGWROOOA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|