C11H12F2N2O5 — CID 106168769
N-(2,2-difluoro-3-hydroxypropyl)-2-methoxy-6-nitrobenzamide (PubChem CID 106168769) has the molecular formula C11H12F2N2O5 and a molecular weight of 290.22 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2-methoxy-6-nitrobenzamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2-methoxy-6-nitrobenzamide |
|---|---|
| PubChem CID | 106168769 |
| Molecular Formula | C11H12F2N2O5 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2-methoxy-6-nitrobenzamide |
| SMILES | COc1cccc([N+](=O)[O-])c1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H12F2N2O5/c1-20-8-4-2-3-7(15(18)19)9(8)10(17)14-5-11(12,13)6-16/h2-4,16H,5-6H2,1H3,(H,14,17) |
| InChIKey | JKYKGZQWCLLSEF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|