C12H15F2NO4 — CID 104857991
N-(2,2-difluoro-3-hydroxypropyl)-2,3-dimethoxybenzamide (PubChem CID 104857991) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 104857991 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(F)(F)CO)c1OC |
| InChI | InChI=1S/C12H15F2NO4/c1-18-9-5-3-4-8(10(9)19-2)11(17)15-6-12(13,14)7-16/h3-5,16H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | VQCPDFMVAFHDFD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |