C12H16INO3 — CID 114504514
N-(3-iodopropyl)-2,3-dimethoxybenzamide (PubChem CID 114504514) has the molecular formula C12H16INO3 and a molecular weight of 349.17 g/mol. Its IUPAC name is N-(3-iodopropyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(3-iodopropyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 114504514 |
| Molecular Formula | C12H16INO3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(3-iodopropyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCCI)c1OC |
| InChI | InChI=1S/C12H16INO3/c1-16-10-6-3-5-9(11(10)17-2)12(15)14-8-4-7-13/h3,5-6H,4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | YVVCAKZQUVHHJZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|