C14H21N3O4 — CID 77036754
N-(5-amino-5-hydroxyiminopentyl)-2,3-dimethoxybenzamide (PubChem CID 77036754) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 77036754 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCCCC(N)=NO)c1OC |
| InChI | InChI=1S/C14H21N3O4/c1-20-11-7-5-6-10(13(11)21-2)14(18)16-9-4-3-8-12(15)17-19/h5-7,19H,3-4,8-9H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | SJVDABJJKHVKBG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|