C13H19NO4 — CID 106843372
N-(4-hydroxybutyl)-2,3-dimethoxybenzamide (PubChem CID 106843372) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(4-hydroxybutyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 106843372 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(4-hydroxybutyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCCCO)c1OC |
| InChI | InChI=1S/C13H19NO4/c1-17-11-7-5-6-10(12(11)18-2)13(16)14-8-3-4-9-15/h5-7,15H,3-4,8-9H2,1-2H3,(H,14,16) |
| InChIKey | MQZAUUJTPOMAMH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|