C18H21NO4 — CID 35509323
2,3-dimethoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 35509323) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 35509323 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2,3-dimethoxy-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-21-14-9-7-13(8-10-14)11-12-19-18(20)15-5-4-6-16(22-2)17(15)23-3/h4-10H,11-12H2,1-3H3,(H,19,20) |
| InChIKey | RCNZERHHPNKBBH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |