C19H21NO6 — CID 119255472
2-[4-[2-[(2,3-dimethoxybenzoyl)amino]ethyl]phenoxy]acetic acid (PubChem CID 119255472) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[4-[2-[(2,3-dimethoxybenzoyl)amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(2,3-dimethoxybenzoyl)amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119255472 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[4-[2-[(2,3-dimethoxybenzoyl)amino]ethyl]phenoxy]acetic acid |
| SMILES | COc1cccc(C(=O)NCCc2ccc(OCC(=O)O)cc2)c1OC |
| InChI | InChI=1S/C19H21NO6/c1-24-16-5-3-4-15(18(16)25-2)19(23)20-11-10-13-6-8-14(9-7-13)26-12-17(21)22/h3-9H,10-12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | PXANHVMNYSOBHI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |