C13H19NO5 — CID 55025842
N-(2,2-dimethoxyethyl)-2,3-dimethoxybenzamide (PubChem CID 55025842) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2,3-dimethoxybenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 55025842 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(OC)OC)c1OC |
| InChI | InChI=1S/C13H19NO5/c1-16-10-7-5-6-9(12(10)19-4)13(15)14-8-11(17-2)18-3/h5-7,11H,8H2,1-4H3,(H,14,15) |
| InChIKey | GFBMXAWCOVJMOY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|