C16H19NO5 — CID 121145514
N-[2-(furan-2-yl)-2-methoxyethyl]-2,3-dimethoxybenzamide (PubChem CID 121145514) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-methoxyethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[2-(furan-2-yl)-2-methoxyethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 121145514 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[2-(furan-2-yl)-2-methoxyethyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(OC)c2ccco2)c1OC |
| InChI | InChI=1S/C16H19NO5/c1-19-13-7-4-6-11(15(13)21-3)16(18)17-10-14(20-2)12-8-5-9-22-12/h4-9,14H,10H2,1-3H3,(H,17,18) |
| InChIKey | DUFVZGKLZRTDFQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |