C19H26N2O4 — CID 94813161
N-[(2S)-2-(diethylamino)-2-(furan-2-yl)ethyl]-2,3-dimethoxybenzamide (PubChem CID 94813161) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)-2-(furan-2-yl)ethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(2S)-2-(diethylamino)-2-(furan-2-yl)ethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 94813161 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[(2S)-2-(diethylamino)-2-(furan-2-yl)ethyl]-2,3-dimethoxybenzamide |
| SMILES | CCN(CC)[C@@H](CNC(=O)c1cccc(OC)c1OC)c1ccco1 |
| InChI | InChI=1S/C19H26N2O4/c1-5-21(6-2)15(16-11-8-12-25-16)13-20-19(22)14-9-7-10-17(23-3)18(14)24-4/h7-12,15H,5-6,13H2,1-4H3,(H,20,22)/t15-/m0/s1 |
| InChIKey | PSJRATXIHLNQIN-HNNXBMFYSA-N |
| XLogP | 3.11 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |