C16H18N2O5 — CID 34239119
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,3-dimethoxybenzamide (PubChem CID 34239119) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 34239119 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(=O)NCc2ccco2)c1OC |
| InChI | InChI=1S/C16H18N2O5/c1-21-13-7-3-6-12(15(13)22-2)16(20)18-10-14(19)17-9-11-5-4-8-23-11/h3-8H,9-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | QCHOZLYEAHYPMM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |