C17H19N3O6 — CID 9081389
4-(2-amino-2-oxoethoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-methoxybenzamide (PubChem CID 9081389) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 9081389 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCc2ccco2)ccc1OCC(N)=O |
| InChI | InChI=1S/C17H19N3O6/c1-24-14-7-11(4-5-13(14)26-10-15(18)21)17(23)20-9-16(22)19-8-12-3-2-6-25-12/h2-7H,8-10H2,1H3,(H2,18,21)(H,19,22)(H,20,23) |
| InChIKey | LXFFZZVYHNGWLJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |