C14H11F3N2O3 — CID 112992005
2,3,4-trifluoro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide (PubChem CID 112992005) has the molecular formula C14H11F3N2O3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 112992005 |
| Molecular Formula | C14H11F3N2O3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)c(F)c1F)NCc1ccco1 |
| InChI | InChI=1S/C14H11F3N2O3/c15-10-4-3-9(12(16)13(10)17)14(21)19-7-11(20)18-6-8-2-1-5-22-8/h1-5H,6-7H2,(H,18,20)(H,19,21) |
| InChIKey | LRPHWUKBZYMFOU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|