C19H13F3N2O3 — CID 109046656
1-N-(furan-2-ylmethyl)-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109046656) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 1-N-(furan-2-ylmethyl)-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-(furan-2-ylmethyl)-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109046656 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-N-(furan-2-ylmethyl)-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H13F3N2O3/c20-14-7-8-15(17(22)16(14)21)24-19(26)12-5-3-11(4-6-12)18(25)23-10-13-2-1-9-27-13/h1-9H,10H2,(H,23,25)(H,24,26) |
| InChIKey | CHPBVGPBSDAPEL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|