C20H13F3N2O2 — CID 109049282
1-N-phenyl-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109049282) has the molecular formula C20H13F3N2O2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109049282 |
| Molecular Formula | C20H13F3N2O2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H13F3N2O2/c21-15-10-11-16(18(23)17(15)22)25-20(27)13-8-6-12(7-9-13)19(26)24-14-4-2-1-3-5-14/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | GOSGVTFZZVQZMS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|