C21H15F3N2O2 — CID 109049340
4-N-(2-methylphenyl)-1-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide (PubChem CID 109049340) has the molecular formula C21H15F3N2O2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 4-N-(2-methylphenyl)-1-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-methylphenyl)-1-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109049340 |
| Molecular Formula | C21H15F3N2O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-N-(2-methylphenyl)-1-N-(2,3,4-trifluorophenyl)benzene-1,4-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H15F3N2O2/c1-12-4-2-3-5-16(12)25-20(27)13-6-8-14(9-7-13)21(28)26-17-11-10-15(22)18(23)19(17)24/h2-11H,1H3,(H,25,27)(H,26,28) |
| InChIKey | AVIQAGYPMUWETL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|