C26H18F4N2O2 — CID 139202270
N-(2,3-difluorophenyl)benzamide (PubChem CID 139202270) has the molecular formula C26H18F4N2O2 and a molecular weight of 466.43 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)benzamide.
| Compound Name | N-(2,3-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 139202270 |
| Molecular Formula | C26H18F4N2O2 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-(2,3-difluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1F)c1ccccc1.O=C(Nc1cccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/2C13H9F2NO/c2*14-10-7-4-8-11(12(10)15)16-13(17)9-5-2-1-3-6-9/h2*1-8H,(H,16,17) |
| InChIKey | GQSQGUMQRIGNFI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |