C14H10F2N2O2 — CID 152765768
3-benzamido-2,6-difluorobenzamide (PubChem CID 152765768) has the molecular formula C14H10F2N2O2 and a molecular weight of 276.24 g/mol. Its IUPAC name is 3-benzamido-2,6-difluorobenzamide.
| Compound Name | 3-benzamido-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 152765768 |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-benzamido-2,6-difluorobenzamide |
| SMILES | NC(=O)c1c(F)ccc(NC(=O)c2ccccc2)c1F |
| InChI | InChI=1S/C14H10F2N2O2/c15-9-6-7-10(12(16)11(9)13(17)19)18-14(20)8-4-2-1-3-5-8/h1-7H,(H2,17,19)(H,18,20) |
| InChIKey | BTRLNQMJTWMOHF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |