C21H16F2N2O2 — CID 175986307
N-[2,4-difluoro-3-[(2-phenylacetyl)amino]phenyl]benzamide (PubChem CID 175986307) has the molecular formula C21H16F2N2O2 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[(2-phenylacetyl)amino]phenyl]benzamide.
| Compound Name | N-[2,4-difluoro-3-[(2-phenylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 175986307 |
| Molecular Formula | C21H16F2N2O2 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[2,4-difluoro-3-[(2-phenylacetyl)amino]phenyl]benzamide |
| SMILES | O=C(Cc1ccccc1)Nc1c(F)ccc(NC(=O)c2ccccc2)c1F |
| InChI | InChI=1S/C21H16F2N2O2/c22-16-11-12-17(24-21(27)15-9-5-2-6-10-15)19(23)20(16)25-18(26)13-14-7-3-1-4-8-14/h1-12H,13H2,(H,24,27)(H,25,26) |
| InChIKey | JOVCQPGCFHNBKY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |