C8H8F2N2O3S — CID 169218137
2,6-difluoro-3-(methanesulfonamido)benzamide (PubChem CID 169218137) has the molecular formula C8H8F2N2O3S and a molecular weight of 250.23 g/mol. Its IUPAC name is 2,6-difluoro-3-(methanesulfonamido)benzamide.
| Compound Name | 2,6-difluoro-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 169218137 |
| Molecular Formula | C8H8F2N2O3S |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2,6-difluoro-3-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C8H8F2N2O3S/c1-16(14,15)12-5-3-2-4(9)6(7(5)10)8(11)13/h2-3,12H,1H3,(H2,11,13) |
| InChIKey | AZMXGAVVXGIZDP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |