C11H15FN2O4S — CID 71207999
6-fluoro-2-methoxy-3-(propylsulfonylamino)benzamide (PubChem CID 71207999) has the molecular formula C11H15FN2O4S and a molecular weight of 290.32 g/mol. Its IUPAC name is 6-fluoro-2-methoxy-3-(propylsulfonylamino)benzamide.
| Compound Name | 6-fluoro-2-methoxy-3-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 71207999 |
| Molecular Formula | C11H15FN2O4S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 6-fluoro-2-methoxy-3-(propylsulfonylamino)benzamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C(N)=O)c1OC |
| InChI | InChI=1S/C11H15FN2O4S/c1-3-6-19(16,17)14-8-5-4-7(12)9(11(13)15)10(8)18-2/h4-5,14H,3,6H2,1-2H3,(H2,13,15) |
| InChIKey | OWWAACJMYCDKPG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |