C17H21ClFN3O3S — CID 143860411
N-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]-2-chloro-6-fluoro-3-(propylsulfonylamino)benzamide (PubChem CID 143860411) has the molecular formula C17H21ClFN3O3S and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]-2-chloro-6-fluoro-3-(propylsulfonylamino)benzamide.
| Compound Name | N-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]-2-chloro-6-fluoro-3-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 143860411 |
| Molecular Formula | C17H21ClFN3O3S |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[(2E,4Z)-6-aminohepta-2,4,6-trien-3-yl]-2-chloro-6-fluoro-3-(propylsulfonylamino)benzamide |
| SMILES | C=C(N)/C=C\C(=C/C)NC(=O)c1c(F)ccc(NS(=O)(=O)CCC)c1Cl |
| InChI | InChI=1S/C17H21ClFN3O3S/c1-4-10-26(24,25)22-14-9-8-13(19)15(16(14)18)17(23)21-12(5-2)7-6-11(3)20/h5-9,22H,3-4,10,20H2,1-2H3,(H,21,23)/b7-6-,12-5+ |
| InChIKey | DBKMVAWYWTYXOC-BZNMCICSSA-N |
| XLogP | 3.29 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|