C14H19ClFNO4S — CID 66827084
butyl 6-chloro-2-fluoro-3-(propylsulfonylamino)benzoate (PubChem CID 66827084) has the molecular formula C14H19ClFNO4S and a molecular weight of 351.83 g/mol. Its IUPAC name is butyl 6-chloro-2-fluoro-3-(propylsulfonylamino)benzoate.
| Compound Name | butyl 6-chloro-2-fluoro-3-(propylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 66827084 |
| Molecular Formula | C14H19ClFNO4S |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | butyl 6-chloro-2-fluoro-3-(propylsulfonylamino)benzoate |
| SMILES | CCCCOC(=O)c1c(Cl)ccc(NS(=O)(=O)CCC)c1F |
| InChI | InChI=1S/C14H19ClFNO4S/c1-3-5-8-21-14(18)12-10(15)6-7-11(13(12)16)17-22(19,20)9-4-2/h6-7,17H,3-5,8-9H2,1-2H3 |
| InChIKey | KJLSXFFQSWLXKN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|