C19H24ClFN4O3S — CID 126647700
N-[6-(butan-2-ylamino)-3-pyridinyl]-6-chloro-2-fluoro-3-(propylsulfonylamino)benzamide (PubChem CID 126647700) has the molecular formula C19H24ClFN4O3S and a molecular weight of 442.94 g/mol. Its IUPAC name is N-[6-(butan-2-ylamino)-3-pyridinyl]-6-chloro-2-fluoro-3-(propylsulfonylamino)benzamide.
| Compound Name | N-[6-(butan-2-ylamino)-3-pyridinyl]-6-chloro-2-fluoro-3-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 126647700 |
| Molecular Formula | C19H24ClFN4O3S |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[6-(butan-2-ylamino)-3-pyridinyl]-6-chloro-2-fluoro-3-(propylsulfonylamino)benzamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(Cl)c(C(=O)Nc2ccc(NC(C)CC)nc2)c1F |
| InChI | InChI=1S/C19H24ClFN4O3S/c1-4-10-29(27,28)25-15-8-7-14(20)17(18(15)21)19(26)24-13-6-9-16(22-11-13)23-12(3)5-2/h6-9,11-12,25H,4-5,10H2,1-3H3,(H,22,23)(H,24,26) |
| InChIKey | BOSRVXGWUBNZMH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |