About methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate
methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate (PubChem CID 163535802) has the molecular formula C17H19Cl2N5O4S
and a molecular weight of 460.34 g/mol. Its IUPAC name is methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate.
Molecular Properties
| Compound Name | methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate |
| PubChem CID | 163535802 |
| Molecular Formula | C17H19Cl2N5O4S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cc(NC(=O)c2c(Cl)ccc(NS(=O)(=O)CCC)c2Cl)cnc1N |
| InChI | InChI=1S/C17H19Cl2N5O4S/c1-3-6-29(26,27)24-12-5-4-11(18)13(14(12)19)17(25)23-9-7-10(16(21)28-2)15(20)22-8-9/h4-5,7-8,21,24H,3,6H2,1-2H3,(H2,20,22)(H,23,25)/b21-16- |
| InChIKey | DWVWKCBRDKRJCI-PGMHBOJBSA-N |
| XLogP | 3.35 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate?
The IUPAC name of methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate (CID 163535802) is methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate.
What is the SMILES notation for methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate?
The canonical SMILES for methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate is [H]/N=C(\OC)c1cc(NC(=O)c2c(Cl)ccc(NS(=O)(=O)CCC)c2Cl)cnc1N.
What is the InChIKey of methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate?
The InChIKey is DWVWKCBRDKRJCI-PGMHBOJBSA-N. The full InChI is InChI=1S/C17H19Cl2N5O4S/c1-3-6-29(26,27)24-12-5-4-11(18)13(14(12)19)17(25)23-9-7-10(16(21)28-2)15(20)22-8-9/h4-5,7-8,21,24H,3,6H2,1-2H3,(H2,20,22)(H,23,25)/b21-16-.
What are the key properties of methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate?
methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate has a molecular weight of 460.34 g/mol, XLogP of 3.35, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-5-[[2,6-dichloro-3-(propylsulfonylamino)benzoyl]amino]pyridine-3-carboximidate is sourced from PubChem (CID 163535802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).