C15H15Cl2N5O2 — CID 123643244
methyl 4-amino-6-[(3,4-dichlorophenyl)methylcarbamoylamino]pyridine-3-carboximidate (PubChem CID 123643244) has the molecular formula C15H15Cl2N5O2 and a molecular weight of 368.22 g/mol. Its IUPAC name is methyl 4-amino-6-[(3,4-dichlorophenyl)methylcarbamoylamino]pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-6-[(3,4-dichlorophenyl)methylcarbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123643244 |
| Molecular Formula | C15H15Cl2N5O2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | methyl 4-amino-6-[(3,4-dichlorophenyl)methylcarbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cnc(NC(=O)NCc2ccc(Cl)c(Cl)c2)cc1N |
| InChI | InChI=1S/C15H15Cl2N5O2/c1-24-14(19)9-7-20-13(5-12(9)18)22-15(23)21-6-8-2-3-10(16)11(17)4-8/h2-5,7,19H,6H2,1H3,(H4,18,20,21,22,23)/b19-14- |
| InChIKey | AQSQFBGEBIFMOY-RGEXLXHISA-N |
| XLogP | 3.26 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|