C9H13N5O2 — CID 144599211
ethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate (PubChem CID 144599211) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is ethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate.
| Compound Name | ethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate |
|---|---|
| PubChem CID | 144599211 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | ethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OCC)c1cnc(NC(N)=O)cc1N |
| InChI | InChI=1S/C9H13N5O2/c1-2-16-8(11)5-4-13-7(3-6(5)10)14-9(12)15/h3-4,11H,2H2,1H3,(H5,10,12,13,14,15)/b11-8- |
| InChIKey | KDAVDROTYJCCCD-FLIBITNWSA-N |
| XLogP | 0.52 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|