C19H25N5O4 — CID 123531420
2-methoxyethyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate (PubChem CID 123531420) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-methoxyethyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate.
| Compound Name | 2-methoxyethyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123531420 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-methoxyethyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OCCOC)c1cnc(NC(=O)NC(c2ccccc2)C(C)O)cc1N |
| InChI | InChI=1S/C19H25N5O4/c1-12(25)17(13-6-4-3-5-7-13)24-19(26)23-16-10-15(20)14(11-22-16)18(21)28-9-8-27-2/h3-7,10-12,17,21,25H,8-9H2,1-2H3,(H4,20,22,23,24,26)/b21-18- |
| InChIKey | LIWGKEXFGOPMRD-UZYVYHOESA-N |
| XLogP | 1.90 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|