C17H20ClN5O2 — CID 123473234
methyl 4-amino-6-[1-(4-chloro-3-methylphenyl)ethylcarbamoylamino]pyridine-3-carboximidate (PubChem CID 123473234) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl 4-amino-6-[1-(4-chloro-3-methylphenyl)ethylcarbamoylamino]pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-6-[1-(4-chloro-3-methylphenyl)ethylcarbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123473234 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl 4-amino-6-[1-(4-chloro-3-methylphenyl)ethylcarbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cnc(NC(=O)NC(C)c2ccc(Cl)c(C)c2)cc1N |
| InChI | InChI=1S/C17H20ClN5O2/c1-9-6-11(4-5-13(9)18)10(2)22-17(24)23-15-7-14(19)12(8-21-15)16(20)25-3/h4-8,10,20H,1-3H3,(H4,19,21,22,23,24)/b20-16- |
| InChIKey | KQNNNYMRJVAKEY-SILNSSARSA-N |
| XLogP | 3.48 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|