C16H20N6O — CID 135293192
1-[4-amino-5-(N'-methylcarbamimidoyl)-2-pyridinyl]-3-(1-phenylethyl)urea (PubChem CID 135293192) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[4-amino-5-(N'-methylcarbamimidoyl)-2-pyridinyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[4-amino-5-(N'-methylcarbamimidoyl)-2-pyridinyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 135293192 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[4-amino-5-(N'-methylcarbamimidoyl)-2-pyridinyl]-3-(1-phenylethyl)urea |
| SMILES | C/N=C(\N)c1cnc(NC(=O)NC(C)c2ccccc2)cc1N |
| InChI | InChI=1S/C16H20N6O/c1-10(11-6-4-3-5-7-11)21-16(23)22-14-8-13(17)12(9-20-14)15(18)19-2/h3-10H,1-2H3,(H2,18,19)(H4,17,20,21,22,23) |
| InChIKey | NIUVHZKVKDIMBZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|