C20H22N6O2 — CID 123347814
1-[4-amino-5-[N'-(3-oxocyclopenten-1-yl)carbamimidoyl]-2-pyridinyl]-3-(1-phenylethyl)urea (PubChem CID 123347814) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[4-amino-5-[N'-(3-oxocyclopenten-1-yl)carbamimidoyl]-2-pyridinyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[4-amino-5-[N'-(3-oxocyclopenten-1-yl)carbamimidoyl]-2-pyridinyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 123347814 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[4-amino-5-[N'-(3-oxocyclopenten-1-yl)carbamimidoyl]-2-pyridinyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)Nc1cc(N)c(/C(N)=N/C2=CC(=O)CC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C20H22N6O2/c1-12(13-5-3-2-4-6-13)24-20(28)26-18-10-17(21)16(11-23-18)19(22)25-14-7-8-15(27)9-14/h2-6,9-12H,7-8H2,1H3,(H2,22,25)(H4,21,23,24,26,28) |
| InChIKey | QSUIAOBHLNBMRY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|