C17H19FN6O3 — CID 123585268
methyl N-[amino-[4-amino-6-[1-(2-fluorophenyl)ethylcarbamoylamino]-3-pyridinyl]methylidene]carbamate (PubChem CID 123585268) has the molecular formula C17H19FN6O3 and a molecular weight of 374.38 g/mol. Its IUPAC name is methyl N-[amino-[4-amino-6-[1-(2-fluorophenyl)ethylcarbamoylamino]-3-pyridinyl]methylidene]carbamate.
| Compound Name | methyl N-[amino-[4-amino-6-[1-(2-fluorophenyl)ethylcarbamoylamino]-3-pyridinyl]methylidene]carbamate |
|---|---|
| PubChem CID | 123585268 |
| Molecular Formula | C17H19FN6O3 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | methyl N-[amino-[4-amino-6-[1-(2-fluorophenyl)ethylcarbamoylamino]-3-pyridinyl]methylidene]carbamate |
| SMILES | COC(=O)N=C(N)c1cnc(NC(=O)NC(C)c2ccccc2F)cc1N |
| InChI | InChI=1S/C17H19FN6O3/c1-9(10-5-3-4-6-12(10)18)22-16(25)23-14-7-13(19)11(8-21-14)15(20)24-17(26)27-2/h3-9H,1-2H3,(H2,20,24,26)(H4,19,21,22,23,25) |
| InChIKey | PZRNQSBLEKMLRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|