C18H21F3N6O2 — CID 162593837
1-[4-amino-5-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea (PubChem CID 162593837) has the molecular formula C18H21F3N6O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 1-[4-amino-5-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea.
| Compound Name | 1-[4-amino-5-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 162593837 |
| Molecular Formula | C18H21F3N6O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[4-amino-5-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea |
| SMILES | COC[C@@H](NC(=O)Nc1cc(N)c(/C(N)=N/CC(F)(F)F)cn1)c1ccccc1 |
| InChI | InChI=1S/C18H21F3N6O2/c1-29-9-14(11-5-3-2-4-6-11)26-17(28)27-15-7-13(22)12(8-24-15)16(23)25-10-18(19,20)21/h2-8,14H,9-10H2,1H3,(H2,23,25)(H4,22,24,26,27,28)/t14-/m1/s1 |
| InChIKey | ZJZXQWQGWBMNSI-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|