C24H34N6O3 — CID 144598671
1-[4-amino-5-[N'-[[3-(2-hydroxypropan-2-yl)cyclobutyl]methyl]carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea (PubChem CID 144598671) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-[4-amino-5-[N'-[[3-(2-hydroxypropan-2-yl)cyclobutyl]methyl]carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea.
| Compound Name | 1-[4-amino-5-[N'-[[3-(2-hydroxypropan-2-yl)cyclobutyl]methyl]carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 144598671 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[4-amino-5-[N'-[[3-(2-hydroxypropan-2-yl)cyclobutyl]methyl]carbamimidoyl]-2-pyridinyl]-3-[(1S)-2-methoxy-1-phenylethyl]urea |
| SMILES | COC[C@@H](NC(=O)Nc1cc(N)c(/C(N)=N/CC2CC(C(C)(C)O)C2)cn1)c1ccccc1 |
| InChI | InChI=1S/C24H34N6O3/c1-24(2,32)17-9-15(10-17)12-28-22(26)18-13-27-21(11-19(18)25)30-23(31)29-20(14-33-3)16-7-5-4-6-8-16/h4-8,11,13,15,17,20,32H,9-10,12,14H2,1-3H3,(H2,26,28)(H4,25,27,29,30,31)/t15?,17?,20-/m1/s1 |
| InChIKey | LIOPZAHJRVUMSN-MKJPBZQASA-N |
| XLogP | 2.68 |
| TPSA | 147.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|