C19H25N7O2 — CID 123235333
1-[amino-[4-amino-6-(1-phenylethylcarbamoylamino)-3-pyridinyl]methylidene]-3-propan-2-ylurea (PubChem CID 123235333) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 1-[amino-[4-amino-6-(1-phenylethylcarbamoylamino)-3-pyridinyl]methylidene]-3-propan-2-ylurea.
| Compound Name | 1-[amino-[4-amino-6-(1-phenylethylcarbamoylamino)-3-pyridinyl]methylidene]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 123235333 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[amino-[4-amino-6-(1-phenylethylcarbamoylamino)-3-pyridinyl]methylidene]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N=C(N)c1cnc(NC(=O)NC(C)c2ccccc2)cc1N |
| InChI | InChI=1S/C19H25N7O2/c1-11(2)23-18(27)26-17(21)14-10-22-16(9-15(14)20)25-19(28)24-12(3)13-7-5-4-6-8-13/h4-12H,1-3H3,(H3,21,23,26,27)(H4,20,22,24,25,28) |
| InChIKey | BQTLZKYURPBAQL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 147.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|