C18H22N6O2 — CID 135293235
1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]urea (PubChem CID 135293235) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]urea.
| Compound Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]urea |
|---|---|
| PubChem CID | 135293235 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(4-amino-5-carbamimidoyl-2-pyridinyl)-3-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]urea |
| SMILES | [H]/N=C(\N)c1cnc(NC(=O)N[C@@H](c2ccccc2)[C@@H]2CCCO2)cc1N |
| InChI | InChI=1S/C18H22N6O2/c19-13-9-15(22-10-12(13)17(20)21)23-18(25)24-16(14-7-4-8-26-14)11-5-2-1-3-6-11/h1-3,5-6,9-10,14,16H,4,7-8H2,(H3,20,21)(H4,19,22,23,24,25)/t14-,16-/m0/s1 |
| InChIKey | MSJJUIARBJPLEB-HOCLYGCPSA-N |
| XLogP | 1.99 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|