C21H27N5O4 — CID 118373965
2-methoxyethyl 4-amino-6-[[(S)-(1-hydroxycyclobutyl)-phenylmethyl]carbamoylamino]pyridine-3-carboximidate (PubChem CID 118373965) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-methoxyethyl 4-amino-6-[[(S)-(1-hydroxycyclobutyl)-phenylmethyl]carbamoylamino]pyridine-3-carboximidate.
| Compound Name | 2-methoxyethyl 4-amino-6-[[(S)-(1-hydroxycyclobutyl)-phenylmethyl]carbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 118373965 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-methoxyethyl 4-amino-6-[[(S)-(1-hydroxycyclobutyl)-phenylmethyl]carbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OCCOC)c1cnc(NC(=O)N[C@@H](c2ccccc2)C2(O)CCC2)cc1N |
| InChI | InChI=1S/C21H27N5O4/c1-29-10-11-30-19(23)15-13-24-17(12-16(15)22)25-20(27)26-18(21(28)8-5-9-21)14-6-3-2-4-7-14/h2-4,6-7,12-13,18,23,28H,5,8-11H2,1H3,(H4,22,24,25,26,27)/b23-19-/t18-/m0/s1 |
| InChIKey | LIQPHJDMYTUMBJ-YBAYSFDISA-N |
| XLogP | 2.43 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|