C10H15N5O3 — CID 144599200
2-methoxyethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate (PubChem CID 144599200) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-methoxyethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate.
| Compound Name | 2-methoxyethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate |
|---|---|
| PubChem CID | 144599200 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-methoxyethyl 4-amino-6-(carbamoylamino)pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OCCOC)c1cnc(NC(N)=O)cc1N |
| InChI | InChI=1S/C10H15N5O3/c1-17-2-3-18-9(12)6-5-14-8(4-7(6)11)15-10(13)16/h4-5,12H,2-3H2,1H3,(H5,11,13,14,15,16)/b12-9- |
| InChIKey | SVKHGMLPYCGIBI-XFXZXTDPSA-N |
| XLogP | 0.14 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|