C17H21N5O3 — CID 123695637
methyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate (PubChem CID 123695637) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is methyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 123695637 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | methyl 4-amino-6-[(2-hydroxy-1-phenylpropyl)carbamoylamino]pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1cnc(NC(=O)NC(c2ccccc2)C(C)O)cc1N |
| InChI | InChI=1S/C17H21N5O3/c1-10(23)15(11-6-4-3-5-7-11)22-17(24)21-14-8-13(18)12(9-20-14)16(19)25-2/h3-10,15,19,23H,1-2H3,(H4,18,20,21,22,24)/b19-16- |
| InChIKey | NQYDLMVYNFTGJG-MNDPQUGUSA-N |
| XLogP | 1.88 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|